Products 176689-23-9
CAS 176689-23-9 is the registry number for 2-[4-Nitro-3-(trifluoromethyl)phenyl]acetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
2-[4-nitro-3-(trifluoromethyl)phenyl]acetonitrile (CAS 176689-23-9) is a chemical compound with the molecular formula C9H5F3N2O2 and a molecular weight of 230.14 g/mol. IUPAC name: 2-[4-nitro-3-(trifluoromethyl)phenyl]acetonitrile. InChIKey: BKJDGCNCFIRUNL-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2O2 |
|---|---|
| Molecular weight | 230.14 g/mol |
| IUPAC name | 2-[4-nitro-3-(trifluoromethyl)phenyl]acetonitrile |
| InChIKey | BKJDGCNCFIRUNL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC#N)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)