CAS 1368515-30-3 is the registry number for 1-Bromo-5,8-difluoroisoquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-5,8-difluoroisoquinoline (CAS 1368515-30-3) is a chemical compound with the molecular formula C9H4BrF2N and a molecular weight of 244.03 g/mol. IUPAC name: 1-bromo-5,8-difluoroisoquinoline. InChIKey: VFBCNTCOFREOIK-UHFFFAOYSA-N.
| Molecular formula | C9H4BrF2N |
|---|---|
| Molecular weight | 244.03 g/mol |
| IUPAC name | 1-bromo-5,8-difluoroisoquinoline |
| InChIKey | VFBCNTCOFREOIK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1F)C=CN=C2Br)F |
Computed by PubChem (NCBI)