CAS 2445460-53-5 is the registry number for 4-Bromo-2,6-difluoroquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-2,6-difluoroquinoline (CAS 2445460-53-5) is a chemical compound with the molecular formula C9H4BrF2N and a molecular weight of 244.03 g/mol. IUPAC name: 4-bromo-2,6-difluoroquinoline. InChIKey: SJKNVCPGVPSZSC-UHFFFAOYSA-N.
| Molecular formula | C9H4BrF2N |
|---|---|
| Molecular weight | 244.03 g/mol |
| IUPAC name | 4-bromo-2,6-difluoroquinoline |
| InChIKey | SJKNVCPGVPSZSC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=CC(=N2)F)Br |
Computed by PubChem (NCBI)