CAS 1890680-14-4 is the registry number for 3-Bromo-5,8-difluoroquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-5,8-difluoroquinoline (CAS 1890680-14-4) is a chemical compound with the molecular formula C9H4BrF2N and a molecular weight of 244.03 g/mol. IUPAC name: 3-bromo-5,8-difluoroquinoline. InChIKey: SREHWEZXLXLWRK-UHFFFAOYSA-N.
| Molecular formula | C9H4BrF2N |
|---|---|
| Molecular weight | 244.03 g/mol |
| IUPAC name | 3-bromo-5,8-difluoroquinoline |
| InChIKey | SREHWEZXLXLWRK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1F)C=C(C=N2)Br)F |
Computed by PubChem (NCBI)