CAS 1189164-12-2 is the registry number for 2-Bromo-5,6-dimethyl-1H-benzo[d]imidazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-5,6-dimethyl-1H-benzimidazole (CAS 1189164-12-2) is a chemical compound with the molecular formula C9H9BrN2 and a molecular weight of 225.08 g/mol. IUPAC name: 2-bromo-5,6-dimethyl-1H-benzimidazole. InChIKey: OSFZZXAKWLOBPG-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2 |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 2-bromo-5,6-dimethyl-1H-benzimidazole |
| InChIKey | OSFZZXAKWLOBPG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)N=C(N2)Br |
Computed by PubChem (NCBI)