Products 1189357-50-3
CAS 1189357-50-3 is the registry number for 4-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)but-2-ynoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(9H-fluoren-9-ylmethoxycarbonylamino)but-2-ynoic acid (CAS 1189357-50-3) is a chemical compound with the molecular formula C19H15NO4 and a molecular weight of 321.3 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonylamino)but-2-ynoic acid. InChIKey: IEYYVGHBHUKCPA-UHFFFAOYSA-N.
| Molecular formula | C19H15NO4 |
|---|---|
| Molecular weight | 321.3 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)but-2-ynoic acid |
| InChIKey | IEYYVGHBHUKCPA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC#CC(=O)O |
Computed by PubChem (NCBI)