CAS 1189456-27-6 appears in our catalog under these names: 5-fluoro-1-(tetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione-2-13C-1,3-15N2, 98%, Tegafur-13C-15N2, Tegafur-13C,15N2. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 10 mg, 1 mg.
5-fluoro-1-(oxolan-2-yl)(213C,1,3-15N2)pyrimidine-2,4-dione (CAS 1189456-27-6) is a chemical compound with the molecular formula C8H9FN2O3 and a molecular weight of 203.15 g/mol. IUPAC name: 5-fluoro-1-(oxolan-2-yl)(213C,1,3-15N2)pyrimidine-2,4-dione. InChIKey: WFWLQNSHRPWKFK-HLDOMDIUSA-N.
| Molecular formula | C8H9FN2O3 |
|---|---|
| Molecular weight | 203.15 g/mol |
| IUPAC name | 5-fluoro-1-(oxolan-2-yl)(213C,1,3-15N2)pyrimidine-2,4-dione |
| InChIKey | WFWLQNSHRPWKFK-HLDOMDIUSA-N |
| SMILES | C1CC(OC1)[15N]2C=C(C(=O)[15NH][13C]2=O)F |
Computed by PubChem (NCBI)