CAS 1446413-77-9 is the registry number for 2-Ethoxy-4-fluoro-5-nitroaniline, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-ethoxy-4-fluoro-5-nitroaniline (CAS 1446413-77-9) is a chemical compound with the molecular formula C8H9FN2O3 and a molecular weight of 200.17 g/mol. IUPAC name: 2-ethoxy-4-fluoro-5-nitroaniline. InChIKey: FWTPYXROUXJRBF-UHFFFAOYSA-N.
| Molecular formula | C8H9FN2O3 |
|---|---|
| Molecular weight | 200.17 g/mol |
| IUPAC name | 2-ethoxy-4-fluoro-5-nitroaniline |
| InChIKey | FWTPYXROUXJRBF-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1N)[N+](=O)[O-])F |
Computed by PubChem (NCBI)