CAS 509151-97-7 appears in our catalog under these names: 2-Fluoro-N-(2-hydroxyethyl)-4-nitroaniline, 97%, 2-((2-Fluoro-4-nitrophenyl)amino)ethan-1-ol. Offered by: Combi-blocks, TRC. Available pack sizes: 25g, 5g, 1g, 2,5g.
2-(2-fluoro-4-nitroanilino)ethanol (CAS 509151-97-7) is a chemical compound with the molecular formula C8H9FN2O3 and a molecular weight of 200.17 g/mol. IUPAC name: 2-(2-fluoro-4-nitroanilino)ethanol. InChIKey: QFQBBENWEBUOGW-UHFFFAOYSA-N.
| Molecular formula | C8H9FN2O3 |
|---|---|
| Molecular weight | 200.17 g/mol |
| IUPAC name | 2-(2-fluoro-4-nitroanilino)ethanol |
| InChIKey | QFQBBENWEBUOGW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])F)NCCO |
Computed by PubChem (NCBI)