CAS 63901-83-7 appears in our catalog under these names: 5-fluoro-3-(tetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione, Tegafur Impurity 6. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-fluoro-3-(oxolan-2-yl)-1H-pyrimidine-2,4-dione (CAS 63901-83-7) is a chemical compound with the molecular formula C8H9FN2O3 and a molecular weight of 200.17 g/mol. IUPAC name: 5-fluoro-3-(oxolan-2-yl)-1H-pyrimidine-2,4-dione. InChIKey: MGYWDJWGVICAEL-UHFFFAOYSA-N.
| Molecular formula | C8H9FN2O3 |
|---|---|
| Molecular weight | 200.17 g/mol |
| IUPAC name | 5-fluoro-3-(oxolan-2-yl)-1H-pyrimidine-2,4-dione |
| InChIKey | MGYWDJWGVICAEL-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)N2C(=O)C(=CNC2=O)F |
Computed by PubChem (NCBI)