CAS 1189464-84-3 is the registry number for 4-Chloro-N-(2-(4-hydroxyphenyl)ethyl)benzamide-d4. Offered by: TRC. Available pack sizes: 20mg, 2mg.
4-chloro-2,3,5,6-tetradeuterio-N-[2-(4-hydroxyphenyl)ethyl]benzamide (CAS 1189464-84-3) is a chemical compound with the molecular formula C15H14ClNO2 and a molecular weight of 279.75 g/mol. IUPAC name: 4-chloro-2,3,5,6-tetradeuterio-N-[2-(4-hydroxyphenyl)ethyl]benzamide. InChIKey: ZTLWJYCDAXUIBK-LNFUJOGGSA-N.
| Molecular formula | C15H14ClNO2 |
|---|---|
| Molecular weight | 279.75 g/mol |
| IUPAC name | 4-chloro-2,3,5,6-tetradeuterio-N-[2-(4-hydroxyphenyl)ethyl]benzamide |
| InChIKey | ZTLWJYCDAXUIBK-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)NCCC2=CC=C(C=C2)O)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)