CAS 1189477-14-2 is the registry number for 1-(5-Chloro-2-(2,4-dichlorophenoxy)phenylethanone)-d2 Major. Offered by: TRC. Available pack sizes: 50mg, 5mg.
1-[5-chloro-2-(2,4-dichloro-3,5-dideuteriophenoxy)phenyl]ethanone (CAS 1189477-14-2) is a chemical compound with the molecular formula C14H9Cl3O2 and a molecular weight of 317.6 g/mol. IUPAC name: 1-[5-chloro-2-(2,4-dichloro-3,5-dideuteriophenoxy)phenyl]ethanone. InChIKey: RVZFFCSCPXYAPX-MKANTAFVSA-N.
| Molecular formula | C14H9Cl3O2 |
|---|---|
| Molecular weight | 317.6 g/mol |
| IUPAC name | 1-[5-chloro-2-(2,4-dichloro-3,5-dideuteriophenoxy)phenyl]ethanone |
| InChIKey | RVZFFCSCPXYAPX-MKANTAFVSA-N |
| SMILES | [2H]C1=CC(=C(C(=C1Cl)[2H])Cl)OC2=C(C=C(C=C2)Cl)C(=O)C |
Computed by PubChem (NCBI)