CAS 1189886-69-8 is the registry number for 1-(5-Chloro-2-(2,4-dichlorophenoxy)phenylethanone)-d3. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
1-[5-chloro-2-(2,4-dichloro-3,5,6-trideuteriophenoxy)phenyl]ethanone (CAS 1189886-69-8) is a chemical compound with the molecular formula C14H9Cl3O2 and a molecular weight of 318.6 g/mol. IUPAC name: 1-[5-chloro-2-(2,4-dichloro-3,5,6-trideuteriophenoxy)phenyl]ethanone. InChIKey: RVZFFCSCPXYAPX-YOOLLTNUSA-N.
| Molecular formula | C14H9Cl3O2 |
|---|---|
| Molecular weight | 318.6 g/mol |
| IUPAC name | 1-[5-chloro-2-(2,4-dichloro-3,5,6-trideuteriophenoxy)phenyl]ethanone |
| InChIKey | RVZFFCSCPXYAPX-YOOLLTNUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1OC2=C(C=C(C=C2)Cl)C(=O)C)Cl)[2H])Cl)[2H] |
Computed by PubChem (NCBI)