CAS 1189500-68-2 appears in our catalog under these names: Acebutolol-d5, >95% (HPLC), Acebutolol–d5, Acebutolol-d5, 99.72%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 50mg, 1 mg.
N-[3-acetyl-4-[1,1,2,3,3-pentadeuterio-2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]butanamide (CAS 1189500-68-2) is a chemical compound with the molecular formula C18H28N2O4 and a molecular weight of 341.5 g/mol. IUPAC name: N-[3-acetyl-4-[1,1,2,3,3-pentadeuterio-2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]butanamide. InChIKey: GOEMGAFJFRBGGG-FPQCMJPGSA-N.
| Molecular formula | C18H28N2O4 |
|---|---|
| Molecular weight | 341.5 g/mol |
| IUPAC name | N-[3-acetyl-4-[1,1,2,3,3-pentadeuterio-2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]butanamide |
| InChIKey | GOEMGAFJFRBGGG-FPQCMJPGSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])OC1=C(C=C(C=C1)NC(=O)CCC)C(=O)C)O)NC(C)C |
Computed by PubChem (NCBI)