Products 2007916-37-0
CAS 2007916-37-0 is the registry number for (R)-Methyl 2-(benzylamino)-3-((tert-butoxycarbonyl)amino)-3-methylbutanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Methyl (2R)-2-(benzylamino)-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 2007916-37-0) is a chemical compound with the molecular formula C18H28N2O4 and a molecular weight of 336.4 g/mol. IUPAC name: methyl (2R)-2-(benzylamino)-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: XQGGDDKJDXCGBU-AWEZNQCLSA-N.
| Molecular formula | C18H28N2O4 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | methyl (2R)-2-(benzylamino)-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | XQGGDDKJDXCGBU-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)[C@H](C(=O)OC)NCC1=CC=CC=C1 |
Computed by PubChem (NCBI)