CAS 2701782-36-5 appears in our catalog under these names: Acebutolol D7, Acebutolol-d7, >95% (HPLC), (±)-Acebutolol-d7 (iso-propyl-d7), 99 atom % D, min 98% Chemical Purity, D7-Acebutolol, Concentration: 100 µg/ml Solvent: Methanol, Acebutolol-d7. Offered by: GLPBio, TRC, CDN, HPC Standards, MedChemExpress. Available pack sizes: 5mg, 0,5mg, 1mg, 2,5mg, 0,01g, 0,005g, 10mg, 1x1ml.
N-[3-acetyl-4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenyl]butanamide (CAS 2701782-36-5) is a chemical compound with the molecular formula C18H28N2O4 and a molecular weight of 343.5 g/mol. IUPAC name: N-[3-acetyl-4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenyl]butanamide. InChIKey: GOEMGAFJFRBGGG-JLTHDCAWSA-N.
| Molecular formula | C18H28N2O4 |
|---|---|
| Molecular weight | 343.5 g/mol |
| IUPAC name | N-[3-acetyl-4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenyl]butanamide |
| InChIKey | GOEMGAFJFRBGGG-JLTHDCAWSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCC(COC1=C(C=C(C=C1)NC(=O)CCC)C(=O)C)O |
Computed by PubChem (NCBI)