Products 2102410-66-0
CAS 2102410-66-0 is the registry number for Di-tert-butyl 4-(dimethylamino)phenyliminodicarbonate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Tert-butyl N-[4-(dimethylamino)phenyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 2102410-66-0) is a chemical compound with the molecular formula C18H28N2O4 and a molecular weight of 336.4 g/mol. IUPAC name: tert-butyl N-[4-(dimethylamino)phenyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: WCLRKWGLASKMDH-UHFFFAOYSA-N.
| Molecular formula | C18H28N2O4 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | tert-butyl N-[4-(dimethylamino)phenyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | WCLRKWGLASKMDH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=CC=C(C=C1)N(C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)