CAS 1189694-51-6 appears in our catalog under these names: Loratadine Epoxide, Loratadine Epoxide, >95% (HPLC). Offered by: Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: on request, 100mg, 250mg, 25mg, 50mg, 500mg.
CAS 1189694-51-6 identifies a chemical compound with the molecular formula C22H23ClN2O3 and a molecular weight of 398.9 g/mol. InChIKey: AHZBXSSTBLMSKB-UHFFFAOYSA-N.
| Molecular formula | C22H23ClN2O3 |
|---|---|
| Molecular weight | 398.9 g/mol |
| InChIKey | AHZBXSSTBLMSKB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCC2(CC1)C3(O2)C4=C(CCC5=C3N=CC=C5)C=C(C=C4)Cl |
Computed by PubChem (NCBI)