CAS 183483-15-0 appears in our catalog under these names: 3-Hydroxy Loratadine, Methyl Analogue of Loratadine, Loratadine 3-Hydroxy Impurity, Loratadine Impurity 24, 3-Hydroxy Loratadine, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2mg.
Ethyl 4-(13-chloro-6-hydroxy-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate (CAS 183483-15-0) is a chemical compound with the molecular formula C22H23ClN2O3 and a molecular weight of 398.9 g/mol. IUPAC name: ethyl 4-(13-chloro-6-hydroxy-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate. InChIKey: KCVVQHZYLIQAEG-UHFFFAOYSA-N.
| Molecular formula | C22H23ClN2O3 |
|---|---|
| Molecular weight | 398.9 g/mol |
| IUPAC name | ethyl 4-(13-chloro-6-hydroxy-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate |
| InChIKey | KCVVQHZYLIQAEG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCC(=C2C3=C(CCC4=C2N=CC(=C4)O)C=C(C=C3)Cl)CC1 |
Computed by PubChem (NCBI)