CAS 403484-49-1 appears in our catalog under these names: Loratadine Impurity 40, Loratadine Impurity 50. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Ethyl 4-(13-chloro-10-oxo-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperidine-1-carboxylate (CAS 403484-49-1) is a chemical compound with the molecular formula C22H23ClN2O3 and a molecular weight of 398.9 g/mol. IUPAC name: ethyl 4-(13-chloro-10-oxo-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperidine-1-carboxylate. InChIKey: WUBQDVFIICWKPH-UHFFFAOYSA-N.
| Molecular formula | C22H23ClN2O3 |
|---|---|
| Molecular weight | 398.9 g/mol |
| IUPAC name | ethyl 4-(13-chloro-10-oxo-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperidine-1-carboxylate |
| InChIKey | WUBQDVFIICWKPH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCC(CC1)C2C3=C(C=C(C=C3)Cl)C(=O)CC4=C2N=CC=C4 |
Computed by PubChem (NCBI)