Products 165739-62-8
CAS 165739-62-8 appears in our catalog under these names: Loratadine n-oxide, 95%, Loratadine N-Oxide, Loratadine N-Oxide, >95% (HPLC), Loratadine N–oxide. Offered by: Combi-blocks, Chemat Brand, TRC, AmBeed, Mikromol. Available pack sizes: 100mg, on request, 10mg, 25mg, 50mg, 1mg, 5mg, 2mg.
Ethyl 4-(13-chloro-4-oxido-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate (CAS 165739-62-8) is a chemical compound with the molecular formula C22H23ClN2O3 and a molecular weight of 398.9 g/mol. IUPAC name: ethyl 4-(13-chloro-4-oxido-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate. InChIKey: AEYRDESTWAYZTA-UHFFFAOYSA-N.
| Molecular formula | C22H23ClN2O3 |
|---|---|
| Molecular weight | 398.9 g/mol |
| IUPAC name | ethyl 4-(13-chloro-4-oxido-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate |
| InChIKey | AEYRDESTWAYZTA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCC(=C2C3=C(CCC4=C2[N+](=CC=C4)[O-])C=C(C=C3)Cl)CC1 |
Computed by PubChem (NCBI)