CAS 1189715-49-8 is the registry number for rac-Nicotine-1,2',3',4',5',6'-13C6. Offered by: TRC. Available pack sizes: 0,5mg, 10mg, 1mg.
3-(1-methyl(213C)azolidin-2-yl)(2,3,4,5,6-13C5)pyridine (CAS 1189715-49-8) is a chemical compound with the molecular formula C10H14N2 and a molecular weight of 168.19 g/mol. IUPAC name: 3-(1-methyl(213C)azolidin-2-yl)(2,3,4,5,6-13C5)pyridine. InChIKey: SNICXCGAKADSCV-NXGVJODUSA-N.
| Molecular formula | C10H14N2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 3-(1-methyl(213C)azolidin-2-yl)(2,3,4,5,6-13C5)pyridine |
| InChIKey | SNICXCGAKADSCV-NXGVJODUSA-N |
| SMILES | CN1CCC[13CH]1[13C]2=[13CH]N=[13CH][13CH]=[13CH]2 |
Computed by PubChem (NCBI)