CAS 909014-86-4 is the registry number for rac-Nicotine-13CD3, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg, 5mg.
3-[1-(trideuterio(113C)methyl)pyrrolidin-2-yl]pyridine (CAS 909014-86-4) is a chemical compound with the molecular formula C10H14N2 and a molecular weight of 166.24 g/mol. IUPAC name: 3-[1-(trideuterio(113C)methyl)pyrrolidin-2-yl]pyridine. InChIKey: SNICXCGAKADSCV-KQORAOOSSA-N.
| Molecular formula | C10H14N2 |
|---|---|
| Molecular weight | 166.24 g/mol |
| IUPAC name | 3-[1-(trideuterio(113C)methyl)pyrrolidin-2-yl]pyridine |
| InChIKey | SNICXCGAKADSCV-KQORAOOSSA-N |
| SMILES | [2H][13C]([2H])([2H])N1CCCC1C2=CN=CC=C2 |
Computed by PubChem (NCBI)