CAS 284685-07-0 appears in our catalog under these names: (S)-(-)-Nicotine-d4, >95% (HPLC), (S)-(-)-Nicotine-d4. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg.
2,3,4,6-tetradeuterio-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine (CAS 284685-07-0) is a chemical compound with the molecular formula C10H14N2 and a molecular weight of 166.26 g/mol. IUPAC name: 2,3,4,6-tetradeuterio-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine. InChIKey: SNICXCGAKADSCV-VJPMMSBNSA-N.
| Molecular formula | C10H14N2 |
|---|---|
| Molecular weight | 166.26 g/mol |
| IUPAC name | 2,3,4,6-tetradeuterio-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
| InChIKey | SNICXCGAKADSCV-VJPMMSBNSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])[C@@H]2CCCN2C)[2H] |
Computed by PubChem (NCBI)