Products 1219805-86-3
CAS 1219805-86-3 appears in our catalog under these names: (±)-Nicotine-d7 (N-methyl-d3, pyridine-d4), >95% (GC), (±)-Nicotine-d7 (N-methyl-d3, pyridine-d4), 98 atom % D, min 98% Chemical Purity, (±)-Nicotine-d7 (N-methyl-d3 pyridine-d4). Offered by: TRC, CDN, Biosynth. Available pack sizes: 10mg, 1mg, 2mg, 0,1g, 0,05g, 50mg, 25mg.
2,3,4,6-tetradeuterio-5-[1-(trideuteriomethyl)pyrrolidin-2-yl]pyridine (CAS 1219805-86-3) is a chemical compound with the molecular formula C10H14N2 and a molecular weight of 169.27 g/mol. IUPAC name: 2,3,4,6-tetradeuterio-5-[1-(trideuteriomethyl)pyrrolidin-2-yl]pyridine. InChIKey: SNICXCGAKADSCV-KJNTWFHBSA-N.
| Molecular formula | C10H14N2 |
|---|---|
| Molecular weight | 169.27 g/mol |
| IUPAC name | 2,3,4,6-tetradeuterio-5-[1-(trideuteriomethyl)pyrrolidin-2-yl]pyridine |
| InChIKey | SNICXCGAKADSCV-KJNTWFHBSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])C2CCCN2C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)