Products 1189717-28-9
CAS 1189717-28-9 is the registry number for 4-Chlorophenyl-1,2-epoxybutane-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
2-[2-(4-chlorophenyl)-1,1-dideuterioethyl]-2,3,3-trideuteriooxirane (CAS 1189717-28-9) is a chemical compound with the molecular formula C10H11ClO and a molecular weight of 187.68 g/mol. IUPAC name: 2-[2-(4-chlorophenyl)-1,1-dideuterioethyl]-2,3,3-trideuteriooxirane. InChIKey: XGQOGVGIYGXEDR-XFPSPQMKSA-N.
| Molecular formula | C10H11ClO |
|---|---|
| Molecular weight | 187.68 g/mol |
| IUPAC name | 2-[2-(4-chlorophenyl)-1,1-dideuterioethyl]-2,3,3-trideuteriooxirane |
| InChIKey | XGQOGVGIYGXEDR-XFPSPQMKSA-N |
| SMILES | [2H]C1(C(O1)([2H])C([2H])([2H])CC2=CC=C(C=C2)Cl)[2H] |
Computed by PubChem (NCBI)