Products 1261394-22-2

CAS 1261394-22-2 is the registry number for Diosmeting 13C d3. Offered by: TRC. Available pack sizes: 25mg.

Structural formula: {0} (CAS {1})

5,7-dihydroxy-2-[3-hydroxy-4-(trideuterio(113C)methoxy)phenyl]chromen-4-one (CAS 1261394-22-2) is a chemical compound with the molecular formula C16H12O6 and a molecular weight of 304.27 g/mol. IUPAC name: 5,7-dihydroxy-2-[3-hydroxy-4-(trideuterio(113C)methoxy)phenyl]chromen-4-one. InChIKey: MBNGWHIJMBWFHU-KQORAOOSSA-N.

Identity
Molecular formulaC16H12O6
Molecular weight304.27 g/mol
IUPAC name5,7-dihydroxy-2-[3-hydroxy-4-(trideuterio(113C)methoxy)phenyl]chromen-4-one
InChIKeyMBNGWHIJMBWFHU-KQORAOOSSA-N
SMILES[2H][13C]([2H])([2H])OC1=C(C=C(C=C1)C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O

Computed by PubChem (NCBI)

Synonyms: Diosmeting 13C d3