Products 1189865-34-6
CAS 1189865-34-6 appears in our catalog under these names: Diethyl n-Butyl-d9-malonate, 99 atom % D, min 98% Chemical Purity, Diethyl butylmalonate-D9, 98%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 50 mg, 25 mg, 100 mg, 10 mg, 5 mg.
Diethyl 2-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)propanedioate (CAS 1189865-34-6) is a chemical compound with the molecular formula C11H20O4 and a molecular weight of 225.33 g/mol. IUPAC name: diethyl 2-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)propanedioate. InChIKey: RPNFNBGRHCUORR-GQWSVURBSA-N.
| Molecular formula | C11H20O4 |
|---|---|
| Molecular weight | 225.33 g/mol |
| IUPAC name | diethyl 2-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)propanedioate |
| InChIKey | RPNFNBGRHCUORR-GQWSVURBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(C(=O)OCC)C(=O)OCC |
Computed by PubChem (NCBI)