Products 1189868-60-7
CAS 1189868-60-7 appears in our catalog under these names: rac 5-Carboxy Desisopropyl Tolterodine-d7, (Rac)-5-Carboxy desisopropyl tolterodine-d7. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
3-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-1-phenylpropyl]-4-hydroxybenzoic acid (CAS 1189868-60-7) is a chemical compound with the molecular formula C19H23NO3 and a molecular weight of 320.4 g/mol. IUPAC name: 3-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-1-phenylpropyl]-4-hydroxybenzoic acid. InChIKey: LXKJBTVDQUGPBU-GYDXGMDDSA-N.
| Molecular formula | C19H23NO3 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 3-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-1-phenylpropyl]-4-hydroxybenzoic acid |
| InChIKey | LXKJBTVDQUGPBU-GYDXGMDDSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCCC(C1=CC=CC=C1)C2=C(C=CC(=C2)C(=O)O)O |
Computed by PubChem (NCBI)