Products 214601-13-5

CAS 214601-13-5 is the registry number for rac 5-Carboxy Desisopropyl Tolterodine, >95% (HPLC). Offered by: TRC. Available pack sizes: 1mg, 2,5mg, 5mg.

Structural formula: {0} (CAS {1})

4-hydroxy-3-[1-phenyl-3-(propan-2-ylamino)propyl]benzoic acid (CAS 214601-13-5) is a chemical compound with the molecular formula C19H23NO3 and a molecular weight of 313.4 g/mol. IUPAC name: 4-hydroxy-3-[1-phenyl-3-(propan-2-ylamino)propyl]benzoic acid. InChIKey: LXKJBTVDQUGPBU-UHFFFAOYSA-N.

Identity
Molecular formulaC19H23NO3
Molecular weight313.4 g/mol
IUPAC name4-hydroxy-3-[1-phenyl-3-(propan-2-ylamino)propyl]benzoic acid
InChIKeyLXKJBTVDQUGPBU-UHFFFAOYSA-N
SMILESCC(C)NCCC(C1=CC=CC=C1)C2=C(C=CC(=C2)C(=O)O)O

Computed by PubChem (NCBI)