CAS 1189878-76-9 appears in our catalog under these names: Zileuton-d4, Zileuton-d4 (major), (±)-Zileuton-d4 (ethyl-d4), 98 atom % D, min 98% Chemical Purity, Zileuton–d4. Offered by: Chemat Brand, Hubei YoungXin, TRC, CDN, GLPBio. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 0,01g.
1-[1-(1-benzothiophen-2-yl)-1,2,2,2-tetradeuterioethyl]-1-hydroxyurea (CAS 1189878-76-9) is a chemical compound with the molecular formula C11H12N2O2S and a molecular weight of 240.32 g/mol. IUPAC name: 1-[1-(1-benzothiophen-2-yl)-1,2,2,2-tetradeuterioethyl]-1-hydroxyurea. InChIKey: MWLSOWXNZPKENC-CWIRFKENSA-N.
| Molecular formula | C11H12N2O2S |
|---|---|
| Molecular weight | 240.32 g/mol |
| IUPAC name | 1-[1-(1-benzothiophen-2-yl)-1,2,2,2-tetradeuterioethyl]-1-hydroxyurea |
| InChIKey | MWLSOWXNZPKENC-CWIRFKENSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C1=CC2=CC=CC=C2S1)N(C(=O)N)O |
Computed by PubChem (NCBI)