Products 1189890-98-9
CAS 1189890-98-9 appears in our catalog under these names: Oxolinic-d5 Acid (ethyl-d5), 98 atom % D, min 98% Chemical Purity, Oxolinic Acid-d5, >95% (HPLC), Oxolinic acid–d5, OXOLINIC ACID-(ETHYL-D5), Oxolinic acid-d5, 98.0%. Offered by: CDN, TRC, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 10mg, 1mg, 500μg, 500 μg, 1 mg, 1x1ml.
8-oxo-5-(1,1,2,2,2-pentadeuterioethyl)-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid (CAS 1189890-98-9) is a chemical compound with the molecular formula C13H11NO5 and a molecular weight of 266.26 g/mol. IUPAC name: 8-oxo-5-(1,1,2,2,2-pentadeuterioethyl)-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid. InChIKey: KYGZCKSPAKDVKC-ZBJDZAJPSA-N.
| Molecular formula | C13H11NO5 |
|---|---|
| Molecular weight | 266.26 g/mol |
| IUPAC name | 8-oxo-5-(1,1,2,2,2-pentadeuterioethyl)-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid |
| InChIKey | KYGZCKSPAKDVKC-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N1C=C(C(=O)C2=CC3=C(C=C21)OCO3)C(=O)O |
Computed by PubChem (NCBI)