CAS 883542-09-4 appears in our catalog under these names: [3-(2-Furoylamino)phenoxy]acetic acid, 95%, 2-(3-(Furan-2-carboxamido)phenoxy)acetic acid, 97%, {3-((Furan-2-carbonyl)-amino)-phenoxy}-acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg, 2,5g.
2-[3-(furan-2-carbonylamino)phenoxy]acetic acid (CAS 883542-09-4) is a chemical compound with the molecular formula C13H11NO5 and a molecular weight of 261.23 g/mol. IUPAC name: 2-[3-(furan-2-carbonylamino)phenoxy]acetic acid. InChIKey: YZZRCBUZPBZOHM-UHFFFAOYSA-N.
| Molecular formula | C13H11NO5 |
|---|---|
| Molecular weight | 261.23 g/mol |
| IUPAC name | 2-[3-(furan-2-carbonylamino)phenoxy]acetic acid |
| InChIKey | YZZRCBUZPBZOHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(=O)O)NC(=O)C2=CC=CO2 |
Computed by PubChem (NCBI)