CAS 92632-81-0 appears in our catalog under these names: 5-(1,3-Dioxoisoindolin-2-yl)-4-oxopentanoic acid, 95%, 5-Phthalimidolevulinic Acid, >95% (HPLC), 2H-Isoindole-2-pentanoic acid, 1,3-dihydro-γ,1,3-trioxo-, 95%+,RG, 95%+,RG. Offered by: Combi-blocks, TRC, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 2,5g, 250mg, 180mg.
5-(1,3-dioxoisoindol-2-yl)-4-oxopentanoic acid (CAS 92632-81-0) is a chemical compound with the molecular formula C13H11NO5 and a molecular weight of 261.23 g/mol. IUPAC name: 5-(1,3-dioxoisoindol-2-yl)-4-oxopentanoic acid. InChIKey: IROQTJRDINLHEO-UHFFFAOYSA-N.
| Molecular formula | C13H11NO5 |
|---|---|
| Molecular weight | 261.23 g/mol |
| IUPAC name | 5-(1,3-dioxoisoindol-2-yl)-4-oxopentanoic acid |
| InChIKey | IROQTJRDINLHEO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC(=O)CCC(=O)O |
Computed by PubChem (NCBI)