Products 312748-79-1
CAS 312748-79-1 is the registry number for [4-(2-Furoylamino)phenoxy]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-[4-(furan-2-carbonylamino)phenoxy]acetic acid (CAS 312748-79-1) is a chemical compound with the molecular formula C13H11NO5 and a molecular weight of 261.23 g/mol. IUPAC name: 2-[4-(furan-2-carbonylamino)phenoxy]acetic acid. InChIKey: DTOMBNXXWIJNMJ-UHFFFAOYSA-N.
| Molecular formula | C13H11NO5 |
|---|---|
| Molecular weight | 261.23 g/mol |
| IUPAC name | 2-[4-(furan-2-carbonylamino)phenoxy]acetic acid |
| InChIKey | DTOMBNXXWIJNMJ-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(=O)NC2=CC=C(C=C2)OCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
[4-(2-furoylamino)phenoxy]acetic acid, 2-(4-(Furan-2-carboxamido)phenoxy)acetic acid, 2-[4-(furan-2-carbonylamino)phenoxy]acetic acid, {4-[(Furan-2-carbonyl)-amino]-phenoxy}-acetic acid, CBMicro_004965, Oprea1_197449, Oprea1_627858, CBDivE_002308, cid_744534, [4-(2-Furoylamino)phenoxy]aceticacid