CAS 1189921-12-7 appears in our catalog under these names: Pyridoxine-d3 HCl, Pyridoxine-d3 hydrochloride, >95% (HPLC), Pyridoxine-d3 Hydrochloride (contains ~1% d0), >95% (HPLC), Pyridoxine–d3 (hydrochloride), Pyridoxine-d3 Hydrochloride. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, Biosynth. Available pack sizes: on request, 10mg, 1mg, 5mg, 2mg, 25mg, 1 mg, 500 μg.
4,5-bis(hydroxymethyl)-2-(trideuteriomethyl)pyridin-3-ol;hydrochloride (CAS 1189921-12-7) is a chemical compound with the molecular formula C8H12ClNO3 and a molecular weight of 208.66 g/mol. IUPAC name: 4,5-bis(hydroxymethyl)-2-(trideuteriomethyl)pyridin-3-ol;hydrochloride. InChIKey: ZUFQODAHGAHPFQ-NIIDSAIPSA-N.
| Molecular formula | C8H12ClNO3 |
|---|---|
| Molecular weight | 208.66 g/mol |
| IUPAC name | 4,5-bis(hydroxymethyl)-2-(trideuteriomethyl)pyridin-3-ol;hydrochloride |
| InChIKey | ZUFQODAHGAHPFQ-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])C1=NC=C(C(=C1O)CO)CO.Cl |
Computed by PubChem (NCBI)