CAS 783325-84-8 is the registry number for 4-Oxooctahydrocyclopenta[c]pyrrole-1-carboxylic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-oxo-2,3,3a,4,5,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid;hydrochloride (CAS 783325-84-8) is a chemical compound with the molecular formula C8H12ClNO3 and a molecular weight of 205.64 g/mol. IUPAC name: 6-oxo-2,3,3a,4,5,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid;hydrochloride. InChIKey: RKANTXGTMRSPRR-UHFFFAOYSA-N.
| Molecular formula | C8H12ClNO3 |
|---|---|
| Molecular weight | 205.64 g/mol |
| IUPAC name | 6-oxo-2,3,3a,4,5,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid;hydrochloride |
| InChIKey | RKANTXGTMRSPRR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2C1C(NC2)C(=O)O.Cl |
Computed by PubChem (NCBI)