CAS 2708343-59-1 is the registry number for Methyl (R)-2-amino-3-(furan-2-yl)propanoate hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Methyl (2R)-2-amino-3-(furan-2-yl)propanoate;hydrochloride (CAS 2708343-59-1) is a chemical compound with the molecular formula C8H12ClNO3 and a molecular weight of 205.64 g/mol. IUPAC name: methyl (2R)-2-amino-3-(furan-2-yl)propanoate;hydrochloride. InChIKey: XKMIIHPOPIUYOE-OGFXRTJISA-N.
| Molecular formula | C8H12ClNO3 |
|---|---|
| Molecular weight | 205.64 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(furan-2-yl)propanoate;hydrochloride |
| InChIKey | XKMIIHPOPIUYOE-OGFXRTJISA-N |
| SMILES | COC(=O)[C@@H](CC1=CC=CO1)N.Cl |
Computed by PubChem (NCBI)