CAS 1219803-04-9 appears in our catalog under these names: rac-Norepinephrine-d6 HCl, DL-Norepinephrine-d6 Hydrochloride, 85%, >95% (HPLC), (±)-Norepinephrine-2,5,6,alpha,beta,beta-d6 HCl, 98 atom % D, min 98% Chemical Purity, (±)–Norepinephrine–d6 (hydrochloride), DL-Norepinephrine-d6 (hydrochloride), 99.75%. Offered by: Chemat Brand, TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 2,5mg, 25mg, 0,01g, 0,005g, 1mg, 5mg.
4-(2-amino-1,2,2-trideuterio-1-hydroxyethyl)-3,5,6-trideuteriobenzene-1,2-diol;hydrochloride (CAS 1219803-04-9) is a chemical compound with the molecular formula C8H12ClNO3 and a molecular weight of 211.67 g/mol. IUPAC name: 4-(2-amino-1,2,2-trideuterio-1-hydroxyethyl)-3,5,6-trideuteriobenzene-1,2-diol;hydrochloride. InChIKey: FQTFHMSZCSUVEU-GVFLBQLQSA-N.
| Molecular formula | C8H12ClNO3 |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 4-(2-amino-1,2,2-trideuterio-1-hydroxyethyl)-3,5,6-trideuteriobenzene-1,2-diol;hydrochloride |
| InChIKey | FQTFHMSZCSUVEU-GVFLBQLQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])(C([2H])([2H])N)O)[2H])O)O)[2H].Cl |
Computed by PubChem (NCBI)