CAS 1189977-29-4 appears in our catalog under these names: rac-Adrenaline-d3 (rac-Epinephrine-d3), rac Epinephrine-d3, >95% (HPLC), (±)-Epinephrine-d3 (N-methyl-d3), 99 atom % D, min 98% Chemical Purity, (±)–Epinephrine–d3. Offered by: Chemat Brand, TRC, CDN, GLPBio. Available pack sizes: on request, 100mg, 10mg, 250mg, 0,05g, 0,01g, 25mg, 5mg.
4-[1-hydroxy-2-(trideuteriomethylamino)ethyl]benzene-1,2-diol (CAS 1189977-29-4) is a chemical compound with the molecular formula C9H13NO3 and a molecular weight of 186.22 g/mol. IUPAC name: 4-[1-hydroxy-2-(trideuteriomethylamino)ethyl]benzene-1,2-diol. InChIKey: UCTWMZQNUQWSLP-FIBGUPNXSA-N.
| Molecular formula | C9H13NO3 |
|---|---|
| Molecular weight | 186.22 g/mol |
| IUPAC name | 4-[1-hydroxy-2-(trideuteriomethylamino)ethyl]benzene-1,2-diol |
| InChIKey | UCTWMZQNUQWSLP-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NCC(C1=CC(=C(C=C1)O)O)O |
Computed by PubChem (NCBI)