CAS 1219803-77-6 appears in our catalog under these names: rac-Adrenaline-d6, rac-Epinephrine-d6 (rac-Adrenaline-d6), (±)-Epinephrine-2,5,6,Alpha,Beta,Beta-d6, >95% (HPLC), (±)-Epinephrine-2,5,6,alpha,beta,beta-d6, 98 atom % D, min 98% Chemical Purity. Offered by: Chemat Brand, TRC, CDN. Available pack sizes: on request, 10mg, 5mg, 0,01g, 0,005g.
3,4,6-trideuterio-5-[1,2,2-trideuterio-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol (CAS 1219803-77-6) is a chemical compound with the molecular formula C9H13NO3 and a molecular weight of 189.24 g/mol. IUPAC name: 3,4,6-trideuterio-5-[1,2,2-trideuterio-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol. InChIKey: UCTWMZQNUQWSLP-JQAOAMCHSA-N.
| Molecular formula | C9H13NO3 |
|---|---|
| Molecular weight | 189.24 g/mol |
| IUPAC name | 3,4,6-trideuterio-5-[1,2,2-trideuterio-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol |
| InChIKey | UCTWMZQNUQWSLP-JQAOAMCHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])(C([2H])([2H])NC)O)[2H])O)O)[2H] |
Computed by PubChem (NCBI)