CAS 1217733-17-9 appears in our catalog under these names: Adrenaline-d3 (Epinephrine-d3), L-(-)-Epinephrine-d3, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5mg, 25mg.
4-[(1R)-1-hydroxy-2-(trideuteriomethylamino)ethyl]benzene-1,2-diol (CAS 1217733-17-9) is a chemical compound with the molecular formula C9H13NO3 and a molecular weight of 186.22 g/mol. IUPAC name: 4-[(1R)-1-hydroxy-2-(trideuteriomethylamino)ethyl]benzene-1,2-diol. InChIKey: UCTWMZQNUQWSLP-XYFUXNRQSA-N.
| Molecular formula | C9H13NO3 |
|---|---|
| Molecular weight | 186.22 g/mol |
| IUPAC name | 4-[(1R)-1-hydroxy-2-(trideuteriomethylamino)ethyl]benzene-1,2-diol |
| InChIKey | UCTWMZQNUQWSLP-XYFUXNRQSA-N |
| SMILES | [2H]C([2H])([2H])NC[C@@H](C1=CC(=C(C=C1)O)O)O |
Computed by PubChem (NCBI)