Products 1189981-81-4
CAS 1189981-81-4 appears in our catalog under these names: O-Desmethyl Metoprolol-d5, O-Desmethylmetoprolol-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
1,1,2,3,3-pentadeuterio-1-[4-(2-hydroxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol (CAS 1189981-81-4) is a chemical compound with the molecular formula C14H23NO3 and a molecular weight of 258.37 g/mol. IUPAC name: 1,1,2,3,3-pentadeuterio-1-[4-(2-hydroxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol. InChIKey: CUKXSBOAIJILRY-UXCJJYBCSA-N.
| Molecular formula | C14H23NO3 |
|---|---|
| Molecular weight | 258.37 g/mol |
| IUPAC name | 1,1,2,3,3-pentadeuterio-1-[4-(2-hydroxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| InChIKey | CUKXSBOAIJILRY-UXCJJYBCSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])OC1=CC=C(C=C1)CCO)O)NC(C)C |
Computed by PubChem (NCBI)