CAS 62572-94-5 appears in our catalog under these names: O–Desmethyl Metoprolol, Metoprolol EP Impurity H (Betaxolol EP Impurity B), Metoprolol EP Impurity H, O-Desmethyl Metoprolol, (2RS)-1-(4-(2-Hydroxyethyl)phenoxy)-3-((1-methylethyl)amino)propan-2-ol. Offered by: GLPBio, Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: 5mg, on request, 10mg, 25mg, 4x25mg, 100mg, 1mg, 1 mg.
1-[4-(2-hydroxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol (CAS 62572-94-5) is a chemical compound with the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. IUPAC name: 1-[4-(2-hydroxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol. InChIKey: CUKXSBOAIJILRY-UHFFFAOYSA-N.
| Molecular formula | C14H23NO3 |
|---|---|
| Molecular weight | 253.34 g/mol |
| IUPAC name | 1-[4-(2-hydroxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| InChIKey | CUKXSBOAIJILRY-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(COC1=CC=C(C=C1)CCO)O |
Computed by PubChem (NCBI)