Products 131564-70-0

CAS 131564-70-0 is the registry number for Betaxolol Impurity 7. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

(2R)-1-[4-(2-hydroxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol (CAS 131564-70-0) is a chemical compound with the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. IUPAC name: (2R)-1-[4-(2-hydroxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol. InChIKey: CUKXSBOAIJILRY-CYBMUJFWSA-N.

Identity
Molecular formulaC14H23NO3
Molecular weight253.34 g/mol
IUPAC name(2R)-1-[4-(2-hydroxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol
InChIKeyCUKXSBOAIJILRY-CYBMUJFWSA-N
SMILESCC(C)NC[C@H](COC1=CC=C(C=C1)CCO)O

Computed by PubChem (NCBI)