Products 2714413-98-4
CAS 2714413-98-4 appears in our catalog under these names: Diphenhydramine-D3 Hydrochloride 0.1 mg/ml in Methanol (as free base), Diphenhydramine-d6 Hydrochloride, >95% (HPLC). Offered by: LoGiCal, TRC. Available pack sizes: 1ml, 1mg, 50mg, 5mg.
2-benzhydryloxy-N-methyl-N-(trideuteriomethyl)ethanamine;hydrochloride (CAS 2714413-98-4) is a chemical compound with the molecular formula C17H22ClNO and a molecular weight of 294.8 g/mol. IUPAC name: 2-benzhydryloxy-N-methyl-N-(trideuteriomethyl)ethanamine;hydrochloride. InChIKey: PCHPORCSPXIHLZ-NIIDSAIPSA-N.
| Molecular formula | C17H22ClNO |
|---|---|
| Molecular weight | 294.8 g/mol |
| IUPAC name | 2-benzhydryloxy-N-methyl-N-(trideuteriomethyl)ethanamine;hydrochloride |
| InChIKey | PCHPORCSPXIHLZ-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])N(C)CCOC(C1=CC=CC=C1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)