CAS 1190225-67-2 is the registry number for Curdionolide A. Offered by: MedChemExpress. Available pack sizes: Get quote.
(6S,9E,11aR)-11a-hydroxy-3,6,10-trimethyl-6,7,8,11-tetrahydro-4H-cyclodeca[b]furan-2,5-dione (CAS 1190225-67-2) is a chemical compound with the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. IUPAC name: (6S,9E,11aR)-11a-hydroxy-3,6,10-trimethyl-6,7,8,11-tetrahydro-4H-cyclodeca[b]furan-2,5-dione. InChIKey: SCOXWKWLFRIELY-CJXNBAGQSA-N.
| Molecular formula | C15H20O4 |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | (6S,9E,11aR)-11a-hydroxy-3,6,10-trimethyl-6,7,8,11-tetrahydro-4H-cyclodeca[b]furan-2,5-dione |
| InChIKey | SCOXWKWLFRIELY-CJXNBAGQSA-N |
| SMILES | C[C@H]1CC/C=C(/C[C@@]2(C(=C(C(=O)O2)C)CC1=O)O)\C |
Computed by PubChem (NCBI)