CAS 1190314-78-3 is the registry number for 7-BROMO-1H-PYRROLO[2,3-C]PYRIDINE-3-CARBOXYLIC ACID, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 100mg, 250mg.
7-bromo-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid (CAS 1190314-78-3) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 7-bromo-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid. InChIKey: UBBINYLJHRGPEW-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 7-bromo-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid |
| InChIKey | UBBINYLJHRGPEW-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=C1C(=CN2)C(=O)O)Br |
Computed by PubChem (NCBI)