CAS 1190321-11-9 appears in our catalog under these names: 3-Formyl-1H-pyrrolo(2,3-b)pyridine-4-carboxylic acid, 95+%, 3-Formyl-7-azaindole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 50mg, 0,5g.
3-formyl-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid (CAS 1190321-11-9) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 3-formyl-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid. InChIKey: VGKXTCSGDWIWKB-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 3-formyl-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid |
| InChIKey | VGKXTCSGDWIWKB-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=C1C(=O)O)C(=CN2)C=O |
Computed by PubChem (NCBI)