CAS 1190360-23-6 appears in our catalog under these names: 3–Bromo–9,9–dimethyl–9H–fluorene, 3-Bromo-9,9-dimethyl-9H-fluorene, >98.0%(GC), 3-Bromo-9,9-dimethyl-9H-fluorene 97%, 3-Bromo-9,9-dimethyl-9H-fluorene, 99%, 99%, 3-Bromo-9,9-dimethyl-9H-fluorene, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 200mg, 250mg, 10g.
3-bromo-9,9-dimethylfluorene (CAS 1190360-23-6) is a chemical compound with the molecular formula C15H13Br and a molecular weight of 273.17 g/mol. IUPAC name: 3-bromo-9,9-dimethylfluorene. InChIKey: VECLPBKDHAALGQ-UHFFFAOYSA-N.
| Molecular formula | C15H13Br |
|---|---|
| Molecular weight | 273.17 g/mol |
| IUPAC name | 3-bromo-9,9-dimethylfluorene |
| InChIKey | VECLPBKDHAALGQ-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)Br)C3=CC=CC=C31)C |
Computed by PubChem (NCBI)